C12H20N2 — CID 596333
2,5-dimethyl-3,6-dipropylpyrazine (PubChem CID 596333) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-dipropylpyrazine.
| Compound Name | 2,5-dimethyl-3,6-dipropylpyrazine |
|---|---|
| PubChem CID | 596333 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,5-dimethyl-3,6-dipropylpyrazine |
| SMILES | CCCc1nc(C)c(CCC)nc1C |
| InChI | InChI=1S/C12H20N2/c1-5-7-11-9(3)14-12(8-6-2)10(4)13-11/h5-8H2,1-4H3 |
| InChIKey | UNTGFIAQBXNWEA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |