About 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine
1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59633490) has the molecular formula C13H12FN5OS
and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 59633490 |
| Molecular Formula | C13H12FN5OS |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCn1nc(S(=O)c2cccc(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C13H12FN5OS/c1-2-19-12-10(11(15)16-7-17-12)13(18-19)21(20)9-5-3-4-8(14)6-9/h3-7H,2H2,1H3,(H2,15,16,17) |
| InChIKey | WAYUBNGNUCALCO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine (CID 59633490) is 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine is CCn1nc(S(=O)c2cccc(F)c2)c2c(N)ncnc21.
What is the InChIKey of 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is WAYUBNGNUCALCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN5OS/c1-2-19-12-10(11(15)16-7-17-12)13(18-19)21(20)9-5-3-4-8(14)6-9/h3-7H,2H2,1H3,(H2,15,16,17).
What are the key properties of 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 305.34 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(3-fluorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 59633490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).