About N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide
N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 59633557) has the molecular formula C12H17BrN6
and a molecular weight of 325.21 g/mol. Its IUPAC name is N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 59633557 |
| Molecular Formula | C12H17BrN6 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ncnc2c1c(Br)nn2C(C)(C)C |
| InChI | InChI=1S/C12H17BrN6/c1-12(2,3)19-11-8(9(13)17-19)10(14-6-15-11)16-7-18(4)5/h6-7H,1-5H3/b16-7+ |
| InChIKey | FBLTWZQOHCWYRR-FRKPEAEDSA-N |
| XLogP | 2.57 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide (CID 59633557) is N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide is CN(C)/C=N/c1ncnc2c1c(Br)nn2C(C)(C)C.
What is the InChIKey of N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide?
The InChIKey is FBLTWZQOHCWYRR-FRKPEAEDSA-N. The full InChI is InChI=1S/C12H17BrN6/c1-12(2,3)19-11-8(9(13)17-19)10(14-6-15-11)16-7-18(4)5/h6-7H,1-5H3/b16-7+.
What are the key properties of N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide?
N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide has a molecular weight of 325.21 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 59633557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).