About 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine
1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59633690) has the molecular formula C14H13ClN6OS
and a molecular weight of 348.82 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 59633690 |
| Molecular Formula | C14H13ClN6OS |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(S(=O)c1cccc(Cl)c1)nn2C1CNC1 |
| InChI | InChI=1S/C14H13ClN6OS/c15-8-2-1-3-10(4-8)23(22)14-11-12(16)18-7-19-13(11)21(20-14)9-5-17-6-9/h1-4,7,9,17H,5-6H2,(H2,16,18,19) |
| InChIKey | VYWWKPXQZLBKLU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine (CID 59633690) is 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine is Nc1ncnc2c1c(S(=O)c1cccc(Cl)c1)nn2C1CNC1.
What is the InChIKey of 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is VYWWKPXQZLBKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN6OS/c15-8-2-1-3-10(4-8)23(22)14-11-12(16)18-7-19-13(11)21(20-14)9-5-17-6-9/h1-4,7,9,17H,5-6H2,(H2,16,18,19).
What are the key properties of 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine?
1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 348.82 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-3-(3-chlorophenyl)sulfinylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 59633690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).