About 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine
1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59633728) has the molecular formula C15H15F2N5O
and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 59633728 |
| Molecular Formula | C15H15F2N5O |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)n1nc(Oc2cc(F)cc(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H15F2N5O/c1-15(2,3)22-13-11(12(18)19-7-20-13)14(21-22)23-10-5-8(16)4-9(17)6-10/h4-7H,1-3H3,(H2,18,19,20) |
| InChIKey | JXRWVEKMMXMIKO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine (CID 59633728) is 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine is CC(C)(C)n1nc(Oc2cc(F)cc(F)c2)c2c(N)ncnc21.
What is the InChIKey of 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is JXRWVEKMMXMIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N5O/c1-15(2,3)22-13-11(12(18)19-7-20-13)14(21-22)23-10-5-8(16)4-9(17)6-10/h4-7H,1-3H3,(H2,18,19,20).
What are the key properties of 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine?
1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 319.32 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(3,5-difluorophenoxy)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 59633728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).