About 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide
4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide (PubChem CID 59634246) has the molecular formula C17H28N2O5S
and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide.
Molecular Properties
| Compound Name | 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide |
| PubChem CID | 59634246 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide |
| SMILES | CC(C)(C)c1cc(CC(=O)C(C)(C)S(=O)(=O)NC2CCOCC2)no1 |
| InChI | InChI=1S/C17H28N2O5S/c1-16(2,3)15-11-13(18-24-15)10-14(20)17(4,5)25(21,22)19-12-6-8-23-9-7-12/h11-12,19H,6-10H2,1-5H3 |
| InChIKey | HNSUBBWJONLHTO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide?
The IUPAC name of 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide (CID 59634246) is 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide.
What is the SMILES notation for 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide?
The canonical SMILES for 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide is CC(C)(C)c1cc(CC(=O)C(C)(C)S(=O)(=O)NC2CCOCC2)no1.
What is the InChIKey of 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide?
The InChIKey is HNSUBBWJONLHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O5S/c1-16(2,3)15-11-13(18-24-15)10-14(20)17(4,5)25(21,22)19-12-6-8-23-9-7-12/h11-12,19H,6-10H2,1-5H3.
What are the key properties of 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide?
4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide has a molecular weight of 372.49 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-N-(oxan-4-yl)-3-oxobutane-2-sulfonamide is sourced from PubChem (CID 59634246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).