About 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one (PubChem CID 59634330) has the molecular formula C17H26F2N2O4S
and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one |
| PubChem CID | 59634330 |
| Molecular Formula | C17H26F2N2O4S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one |
| SMILES | CC(C)(C)c1cc(CC(=O)C(C)(C)S(=O)(=O)N2CCC(F)(F)CC2)no1 |
| InChI | InChI=1S/C17H26F2N2O4S/c1-15(2,3)14-11-12(20-25-14)10-13(22)16(4,5)26(23,24)21-8-6-17(18,19)7-9-21/h11H,6-10H2,1-5H3 |
| InChIKey | QNSROHGKXZTUHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one (CID 59634330) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one is CC(C)(C)c1cc(CC(=O)C(C)(C)S(=O)(=O)N2CCC(F)(F)CC2)no1.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one?
The InChIKey is QNSROHGKXZTUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26F2N2O4S/c1-15(2,3)14-11-12(20-25-14)10-13(22)16(4,5)26(23,24)21-8-6-17(18,19)7-9-21/h11H,6-10H2,1-5H3.
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one?
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one has a molecular weight of 392.47 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4,4-difluoropiperidin-1-yl)sulfonyl-3-methylbutan-2-one is sourced from PubChem (CID 59634330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).