C13H20N2O — CID 59634351
4-tert-butyl-2,6,6-trimethyl-5H-furo[2,3-d]pyrimidine (PubChem CID 59634351) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-tert-butyl-2,6,6-trimethyl-5H-furo[2,3-d]pyrimidine.
| Compound Name | 4-tert-butyl-2,6,6-trimethyl-5H-furo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 59634351 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-tert-butyl-2,6,6-trimethyl-5H-furo[2,3-d]pyrimidine |
| SMILES | Cc1nc2c(c(C(C)(C)C)n1)CC(C)(C)O2 |
| InChI | InChI=1S/C13H20N2O/c1-8-14-10(12(2,3)4)9-7-13(5,6)16-11(9)15-8/h7H2,1-6H3 |
| InChIKey | PQOWBAJFOWEDBJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |