C27H23ClN4O5S — CID 59634873
(3-chlorophenyl) 4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 59634873) has the molecular formula C27H23ClN4O5S and a molecular weight of 551.02 g/mol. Its IUPAC name is (3-chlorophenyl) 4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | (3-chlorophenyl) 4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59634873 |
| Molecular Formula | C27H23ClN4O5S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | (3-chlorophenyl) 4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1)N1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C27H23ClN4O5S/c28-21-6-2-7-23(18-21)37-27(34)32-16-14-31(15-17-32)26(33)20-9-11-22(12-10-20)30-38(35,36)24-8-1-4-19-5-3-13-29-25(19)24/h1-13,18,30H,14-17H2 |
| InChIKey | OPOVILYTUNLANQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |