C27H30N4O5S — CID 59634947
cyclopentyl 4-[3-methyl-4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 59634947) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is cyclopentyl 4-[3-methyl-4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | cyclopentyl 4-[3-methyl-4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59634947 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | cyclopentyl 4-[3-methyl-4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)OC3CCCC3)CC2)ccc1NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C27H30N4O5S/c1-19-18-21(26(32)30-14-16-31(17-15-30)27(33)36-22-8-2-3-9-22)11-12-23(19)29-37(34,35)24-10-4-6-20-7-5-13-28-25(20)24/h4-7,10-13,18,22,29H,2-3,8-9,14-17H2,1H3 |
| InChIKey | YQKZFWHLKQFJOJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |