C13H12FN5O2 — CID 59635491
(3E)-3-[[5-(2-fluoroethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 59635491) has the molecular formula C13H12FN5O2 and a molecular weight of 289.27 g/mol. Its IUPAC name is (3E)-3-[[5-(2-fluoroethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[5-(2-fluoroethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59635491 |
| Molecular Formula | C13H12FN5O2 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (3E)-3-[[5-(2-fluoroethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3ccc(NCCF)nc23)C(=O)N1 |
| InChI | InChI=1S/C13H12FN5O2/c14-2-3-15-10-1-4-19-12(17-10)9(7-16-19)5-8-6-11(20)18-13(8)21/h1,4-5,7H,2-3,6H2,(H,15,17)(H,18,20,21)/b8-5+ |
| InChIKey | STIZKXKUYKLXGZ-VMPITWQZSA-N |
| XLogP | 0.54 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|