C23H25N3O3Y-2 — CID 59635559
N-ethenyl-3-[5-[3-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]furan-2-yl]but-2-enamide;yttrium (PubChem CID 59635559) has the molecular formula C23H25N3O3Y-2 and a molecular weight of 480.38 g/mol. Its IUPAC name is N-ethenyl-3-[5-[3-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]furan-2-yl]but-2-enamide;yttrium.
| Compound Name | N-ethenyl-3-[5-[3-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]furan-2-yl]but-2-enamide;yttrium |
|---|---|
| PubChem CID | 59635559 |
| Molecular Formula | C23H25N3O3Y-2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-ethenyl-3-[5-[3-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]furan-2-yl]but-2-enamide;yttrium |
| SMILES | C=[C-]NC(=O)/[C-]=C(\C)c1ccc(-c2cccc(C(=O)N3CCCN(C)CC3)c2)o1.[Y] |
| InChI | InChI=1S/C23H25N3O3.Y/c1-4-24-22(27)15-17(2)20-9-10-21(29-20)18-7-5-8-19(16-18)23(28)26-12-6-11-25(3)13-14-26;/h5,7-10,16H,1,6,11-14H2,2-3H3,(H,24,27);/q-2; |
| InChIKey | HXDROHQQCMOSQM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|