C32H35F3N2O5Si — CID 59635870
4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59635870) has the molecular formula C32H35F3N2O5Si and a molecular weight of 612.72 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59635870 |
| Molecular Formula | C32H35F3N2O5Si |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]12C=C[C@@](COCc3ccccc3)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C32H35F3N2O5Si/c1-29(2,3)43(4,5)41-16-15-30-13-14-31(42-30,20-40-19-21-9-7-6-8-10-21)26-25(30)27(38)37(28(26)39)23-12-11-22(18-36)24(17-23)32(33,34)35/h6-14,17,25-26H,15-16,19-20H2,1-5H3/t25-,26+,30+,31-/m0/s1 |
| InChIKey | CHOQOXVVYFDUNQ-ZBKRMGPDSA-N |
| XLogP | 6.39 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|