C18H30O5Si — CID 59635943
(1R,2S,6R,7S,8S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 59635943) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S,8S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 59635943 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1R,2S,6R,7S,8S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@H]1C[C@@]2(C)O[C@]1(CCO[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C18H30O5Si/c1-11-10-17(5)12-13(15(20)22-14(12)19)18(11,23-17)8-9-21-24(6,7)16(2,3)4/h11-13H,8-10H2,1-7H3/t11-,12+,13-,17+,18-/m0/s1 |
| InChIKey | WWCIWHXIXJPIGW-OTIOCJJCSA-N |
| XLogP | 3.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|