C24H29F3N2O4Si — CID 59635959
4-[(3aS,4S,7R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59635959) has the molecular formula C24H29F3N2O4Si and a molecular weight of 494.59 g/mol. Its IUPAC name is 4-[(3aS,4S,7R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aS,4S,7R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59635959 |
| Molecular Formula | C24H29F3N2O4Si |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-[(3aS,4S,7R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]12CC[C@H](O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H29F3N2O4Si/c1-22(2,3)34(4,5)32-11-10-23-9-8-17(33-23)18-19(23)21(31)29(20(18)30)15-7-6-14(13-28)16(12-15)24(25,26)27/h6-7,12,17-19H,8-11H2,1-5H3/t17-,18+,19-,23+/m0/s1 |
| InChIKey | YBOAZRWCJBHSRE-QPXQOZNCSA-N |
| XLogP | 5.03 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|