C26H33F3N2O4Si — CID 59636013
4-[(3aR,4S,5S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59636013) has the molecular formula C26H33F3N2O4Si and a molecular weight of 522.64 g/mol. Its IUPAC name is 4-[(3aR,4S,5S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,5S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59636013 |
| Molecular Formula | C26H33F3N2O4Si |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 4-[(3aR,4S,5S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@H]1C[C@@]2(C)O[C@]1(CCO[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H33F3N2O4Si/c1-15-13-24(5)19-20(25(15,35-24)10-11-34-36(6,7)23(2,3)4)22(33)31(21(19)32)17-9-8-16(14-30)18(12-17)26(27,28)29/h8-9,12,15,19-20H,10-11,13H2,1-7H3/t15-,19+,20-,24+,25-/m0/s1 |
| InChIKey | IXAJWPUUVYROHY-GKLSOTOOSA-N |
| XLogP | 5.66 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|