C20H19F3N2O4 — CID 59636040
4-[(3aR,4S,5S,7R,7aS)-4-(2-hydroxyethyl)-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59636040) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-[(3aR,4S,5S,7R,7aS)-4-(2-hydroxyethyl)-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,5S,7R,7aS)-4-(2-hydroxyethyl)-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59636040 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[(3aR,4S,5S,7R,7aS)-4-(2-hydroxyethyl)-5,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@H]1C[C@@]2(C)O[C@]1(CCO)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H19F3N2O4/c1-10-8-18(2)14-15(19(10,29-18)5-6-26)17(28)25(16(14)27)12-4-3-11(9-24)13(7-12)20(21,22)23/h3-4,7,10,14-15,26H,5-6,8H2,1-2H3/t10-,14+,15-,18+,19-/m0/s1 |
| InChIKey | UVAKIEOOEYERDB-MKBUGTKASA-N |
| XLogP | 2.63 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|