C20H18Cl2F3N3O5S — CID 59636081
N-[(1R,2S,4R,5S,8S,12R)-7-(3,5-dichloro-4-cyanophenyl)-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-yl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 59636081) has the molecular formula C20H18Cl2F3N3O5S and a molecular weight of 540.35 g/mol. Its IUPAC name is N-[(1R,2S,4R,5S,8S,12R)-7-(3,5-dichloro-4-cyanophenyl)-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-yl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[(1R,2S,4R,5S,8S,12R)-7-(3,5-dichloro-4-cyanophenyl)-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-yl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 59636081 |
| Molecular Formula | C20H18Cl2F3N3O5S |
| Molecular Weight | 540.35 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | N-[(1R,2S,4R,5S,8S,12R)-7-(3,5-dichloro-4-cyanophenyl)-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-yl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | C[C@@]12C[C@H](NS(=O)(=O)CC(F)(F)F)[C@]3(CCO[C@H]4[C@@H]3[C@@H]1C(=O)N4c1cc(Cl)c(C#N)c(Cl)c1)O2 |
| InChI | InChI=1S/C20H18Cl2F3N3O5S/c1-18-6-13(27-34(30,31)8-20(23,24)25)19(33-18)2-3-32-17-15(19)14(18)16(29)28(17)9-4-11(21)10(7-26)12(22)5-9/h4-5,13-15,17,27H,2-3,6,8H2,1H3/t13-,14+,15-,17-,18+,19-/m0/s1 |
| InChIKey | CPNNQXZXERSHAE-URXDRIIQSA-N |
| XLogP | 2.97 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |