About 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine
2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine (PubChem CID 59636345) has the molecular formula C10H13BrN4
and a molecular weight of 269.15 g/mol. Its IUPAC name is 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 59636345 |
| Molecular Formula | C10H13BrN4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1cnc2cnc(Br)cc21 |
| InChI | InChI=1S/C10H13BrN4/c1-14(2)3-4-15-7-13-8-6-12-10(11)5-9(8)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | SRDXYLABPFJNDU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine (CID 59636345) is 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine is CN(C)CCn1cnc2cnc(Br)cc21.
What is the InChIKey of 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine?
The InChIKey is SRDXYLABPFJNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4/c1-14(2)3-4-15-7-13-8-6-12-10(11)5-9(8)15/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine?
2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine has a molecular weight of 269.15 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromoimidazo[4,5-c]pyridin-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 59636345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).