About cyclohexane;ethanone;tungsten(2+)
cyclohexane;ethanone;tungsten(2+) (PubChem CID 59636637) has the molecular formula C8H14OW
and a molecular weight of 310.04 g/mol. Its IUPAC name is cyclohexane;ethanone;tungsten(2+).
Molecular Properties
| Compound Name | cyclohexane;ethanone;tungsten(2+) |
| PubChem CID | 59636637 |
| Molecular Formula | C8H14OW |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | cyclohexane;ethanone;tungsten(2+) |
| SMILES | C[C-]=O.[CH-]1CCCCC1.[W+2] |
| InChI | InChI=1S/C6H11.C2H3O.W/c1-2-4-6-5-3-1;1-2-3;/h1H,2-6H2;1H3;/q2*-1;+2 |
| InChIKey | KDJGJIKEVAWAKR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;ethanone;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethanone;tungsten(2+)?
The IUPAC name of cyclohexane;ethanone;tungsten(2+) (CID 59636637) is cyclohexane;ethanone;tungsten(2+).
What is the SMILES notation for cyclohexane;ethanone;tungsten(2+)?
The canonical SMILES for cyclohexane;ethanone;tungsten(2+) is C[C-]=O.[CH-]1CCCCC1.[W+2].
What is the InChIKey of cyclohexane;ethanone;tungsten(2+)?
The InChIKey is KDJGJIKEVAWAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11.C2H3O.W/c1-2-4-6-5-3-1;1-2-3;/h1H,2-6H2;1H3;/q2*-1;+2.
What are the key properties of cyclohexane;ethanone;tungsten(2+)?
cyclohexane;ethanone;tungsten(2+) has a molecular weight of 310.04 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethanone;tungsten(2+) is sourced from PubChem (CID 59636637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).