C27H29NO3 — CID 59636864
1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-(2-tert-butyl-3-prop-2-enyl-1H-indol-5-yl)ethanone (PubChem CID 59636864) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-(2-tert-butyl-3-prop-2-enyl-1H-indol-5-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-(2-tert-butyl-3-prop-2-enyl-1H-indol-5-yl)ethanone |
|---|---|
| PubChem CID | 59636864 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-(2-tert-butyl-3-prop-2-enyl-1H-indol-5-yl)ethanone |
| SMILES | C=CCc1c(C(C)(C)C)[nH]c2ccc(CC(=O)C3(c4ccc5c(c4)OCO5)CC3)cc12 |
| InChI | InChI=1S/C27H29NO3/c1-5-6-19-20-13-17(7-9-21(20)28-25(19)26(2,3)4)14-24(29)27(11-12-27)18-8-10-22-23(15-18)31-16-30-22/h5,7-10,13,15,28H,1,6,11-12,14,16H2,2-4H3 |
| InChIKey | USVPYFPVNNDVBC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|