About N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide
N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide (PubChem CID 59636884) has the molecular formula C11H20N2O4S
and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 59636884 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1oncc1S(=O)(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C11H20N2O4S/c1-8-10(7-12-17-8)18(15,16)13-6-9(14)5-11(2,3)4/h7,9,13-14H,5-6H2,1-4H3 |
| InChIKey | QVSIUJFIYYFMIC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide (CID 59636884) is N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide is Cc1oncc1S(=O)(=O)NCC(O)CC(C)(C)C.
What is the InChIKey of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The InChIKey is QVSIUJFIYYFMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4S/c1-8-10(7-12-17-8)18(15,16)13-6-9(14)5-11(2,3)4/h7,9,13-14H,5-6H2,1-4H3.
What are the key properties of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide?
N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide has a molecular weight of 276.36 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 59636884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).