C13H14O3 — CID 59636910
[1-(3,4-dihydro-2H-chromen-6-yl)cyclopropyl] formate (PubChem CID 59636910) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-chromen-6-yl)cyclopropyl] formate.
| Compound Name | [1-(3,4-dihydro-2H-chromen-6-yl)cyclopropyl] formate |
|---|---|
| PubChem CID | 59636910 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [1-(3,4-dihydro-2H-chromen-6-yl)cyclopropyl] formate |
| SMILES | O=COC1(c2ccc3c(c2)CCCO3)CC1 |
| InChI | InChI=1S/C13H14O3/c14-9-16-13(5-6-13)11-3-4-12-10(8-11)2-1-7-15-12/h3-4,8-9H,1-2,5-7H2 |
| InChIKey | PCTKQCJLYNBFBG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|