C17H24FNO4S — CID 59637331
ethyl 2-cyclohexyl-2-[3-fluoro-4-(methanesulfonamido)phenyl]acetate (PubChem CID 59637331) has the molecular formula C17H24FNO4S and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-2-[3-fluoro-4-(methanesulfonamido)phenyl]acetate.
| Compound Name | ethyl 2-cyclohexyl-2-[3-fluoro-4-(methanesulfonamido)phenyl]acetate |
|---|---|
| PubChem CID | 59637331 |
| Molecular Formula | C17H24FNO4S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | ethyl 2-cyclohexyl-2-[3-fluoro-4-(methanesulfonamido)phenyl]acetate |
| SMILES | CCOC(=O)C(c1ccc(NS(C)(=O)=O)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H24FNO4S/c1-3-23-17(20)16(12-7-5-4-6-8-12)13-9-10-15(14(18)11-13)19-24(2,21)22/h9-12,16,19H,3-8H2,1-2H3 |
| InChIKey | STOLPPZZUQSBAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |