C17H33O4P — CID 59637572
[(2S,5R)-5-ethyl-2,4-dimethyloxolan-3-yl]oxy-methyl-[[(2S,5S)-3,4,5-trimethyloxolan-2-yl]methoxy]phosphane (PubChem CID 59637572) has the molecular formula C17H33O4P and a molecular weight of 332.42 g/mol. Its IUPAC name is [(2S,5R)-5-ethyl-2,4-dimethyloxolan-3-yl]oxy-methyl-[[(2S,5S)-3,4,5-trimethyloxolan-2-yl]methoxy]phosphane.
| Compound Name | [(2S,5R)-5-ethyl-2,4-dimethyloxolan-3-yl]oxy-methyl-[[(2S,5S)-3,4,5-trimethyloxolan-2-yl]methoxy]phosphane |
|---|---|
| PubChem CID | 59637572 |
| Molecular Formula | C17H33O4P |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | [(2S,5R)-5-ethyl-2,4-dimethyloxolan-3-yl]oxy-methyl-[[(2S,5S)-3,4,5-trimethyloxolan-2-yl]methoxy]phosphane |
| SMILES | CC[C@H]1O[C@@H](C)C(OP(C)OC[C@H]2O[C@@H](C)C(C)C2C)C1C |
| InChI | InChI=1S/C17H33O4P/c1-8-15-12(4)17(14(6)20-15)21-22(7)18-9-16-11(3)10(2)13(5)19-16/h10-17H,8-9H2,1-7H3/t10?,11?,12?,13-,14-,15+,16+,17?,22?/m0/s1 |
| InChIKey | BSGJAQMNHKSAHQ-NWLUKMKVSA-N |
| XLogP | 4.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|