About (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine
(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine (PubChem CID 59637608) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine.
Molecular Properties
| Compound Name | (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine |
| PubChem CID | 59637608 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine |
| SMILES | [H]/N=C/c1c(-c2ccccc2)no[n+]1[O-] |
| InChI | InChI=1S/C9H7N3O2/c10-6-8-9(11-14-12(8)13)7-4-2-1-3-5-7/h1-6,10H/b10-6+ |
| InChIKey | HYARVFOCMIOREH-UXBLZVDNSA-N |
| XLogP | 0.97 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine?
The IUPAC name of (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine (CID 59637608) is (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine.
What is the SMILES notation for (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine?
The canonical SMILES for (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine is [H]/N=C/c1c(-c2ccccc2)no[n+]1[O-].
What is the InChIKey of (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine?
The InChIKey is HYARVFOCMIOREH-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H7N3O2/c10-6-8-9(11-14-12(8)13)7-4-2-1-3-5-7/h1-6,10H/b10-6+.
What are the key properties of (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine?
(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine has a molecular weight of 189.17 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methanimine is sourced from PubChem (CID 59637608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).