C29H38Si — CID 59637807
4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-(3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane (PubChem CID 59637807) has the molecular formula C29H38Si and a molecular weight of 414.71 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-(3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-(3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 59637807 |
| Molecular Formula | C29H38Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-(3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
| SMILES | C=CCCCC1CC([Si](C)(C)C2C3C=CC=CC3C3C=CC=CC32)C2C=CC=CC12 |
| InChI | InChI=1S/C29H38Si/c1-4-5-6-13-21-20-28(25-17-10-7-14-22(21)25)30(2,3)29-26-18-11-8-15-23(26)24-16-9-12-19-27(24)29/h4,7-12,14-19,21-29H,1,5-6,13,20H2,2-3H3 |
| InChIKey | WQUHNYRLHIDWIQ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|