C45H60Si — CID 59637840
but-3-enyl-[3-[(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-diphenylmethyl]cyclopentyl]-dimethylsilane (PubChem CID 59637840) has the molecular formula C45H60Si and a molecular weight of 629.06 g/mol. Its IUPAC name is but-3-enyl-[3-[(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-diphenylmethyl]cyclopentyl]-dimethylsilane.
| Compound Name | but-3-enyl-[3-[(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-diphenylmethyl]cyclopentyl]-dimethylsilane |
|---|---|
| PubChem CID | 59637840 |
| Molecular Formula | C45H60Si |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 628.45 |
| IUPAC Name | but-3-enyl-[3-[(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-diphenylmethyl]cyclopentyl]-dimethylsilane |
| SMILES | C=CCC[Si](C)(C)C1CCC(C(c2ccccc2)(c2ccccc2)C2C3C=C(C(C)(C)C)C=CC3C3C=CC(C(C)(C)C)=CC32)C1 |
| InChI | InChI=1S/C45H60Si/c1-10-11-28-46(8,9)37-25-22-36(29-37)45(32-18-14-12-15-19-32,33-20-16-13-17-21-33)42-40-30-34(43(2,3)4)23-26-38(40)39-27-24-35(31-41(39)42)44(5,6)7/h10,12-21,23-24,26-27,30-31,36-42H,1,11,22,25,28-29H2,2-9H3 |
| InChIKey | VFCLEQHIFZNXGA-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|