C24H34Si — CID 59637861
4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-cyclopentyl-methyl-pent-4-enylsilane (PubChem CID 59637861) has the molecular formula C24H34Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-cyclopentyl-methyl-pent-4-enylsilane.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-cyclopentyl-methyl-pent-4-enylsilane |
|---|---|
| PubChem CID | 59637861 |
| Molecular Formula | C24H34Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-cyclopentyl-methyl-pent-4-enylsilane |
| SMILES | C=CCCC[Si](C)(C1CCCC1)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C24H34Si/c1-3-4-11-18-25(2,19-12-5-6-13-19)24-22-16-9-7-14-20(22)21-15-8-10-17-23(21)24/h3,7-10,14-17,19-24H,1,4-6,11-13,18H2,2H3 |
| InChIKey | NQKBXQBTIKBOLZ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|