About 1,4-dioxan-2-yl 2-chloroacetate
1,4-dioxan-2-yl 2-chloroacetate (PubChem CID 59637958) has the molecular formula C6H9ClO4
and a molecular weight of 180.59 g/mol. Its IUPAC name is 1,4-dioxan-2-yl 2-chloroacetate.
Molecular Properties
| Compound Name | 1,4-dioxan-2-yl 2-chloroacetate |
| PubChem CID | 59637958 |
| Molecular Formula | C6H9ClO4 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 1,4-dioxan-2-yl 2-chloroacetate |
| SMILES | O=C(CCl)OC1COCCO1 |
| InChI | InChI=1S/C6H9ClO4/c7-3-5(8)11-6-4-9-1-2-10-6/h6H,1-4H2 |
| InChIKey | UJEFHYDGSABSLK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxan-2-yl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxan-2-yl 2-chloroacetate?
The IUPAC name of 1,4-dioxan-2-yl 2-chloroacetate (CID 59637958) is 1,4-dioxan-2-yl 2-chloroacetate.
What is the SMILES notation for 1,4-dioxan-2-yl 2-chloroacetate?
The canonical SMILES for 1,4-dioxan-2-yl 2-chloroacetate is O=C(CCl)OC1COCCO1.
What is the InChIKey of 1,4-dioxan-2-yl 2-chloroacetate?
The InChIKey is UJEFHYDGSABSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO4/c7-3-5(8)11-6-4-9-1-2-10-6/h6H,1-4H2.
What are the key properties of 1,4-dioxan-2-yl 2-chloroacetate?
1,4-dioxan-2-yl 2-chloroacetate has a molecular weight of 180.59 g/mol, XLogP of 0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxan-2-yl 2-chloroacetate is sourced from PubChem (CID 59637958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).