About [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate
[2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 59638006) has the molecular formula C13H22O4S2
and a molecular weight of 306.45 g/mol. Its IUPAC name is [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| PubChem CID | 59638006 |
| Molecular Formula | C13H22O4S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1CSCC(C)S1 |
| InChI | InChI=1S/C13H22O4S2/c1-5-13(3,4)12(15)16-6-10(14)17-11-8-18-7-9(2)19-11/h9,11H,5-8H2,1-4H3 |
| InChIKey | NBIQMVAXVBLANI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate?
The IUPAC name of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate (CID 59638006) is [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate?
The canonical SMILES for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCC(=O)OC1CSCC(C)S1.
What is the InChIKey of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate?
The InChIKey is NBIQMVAXVBLANI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S2/c1-5-13(3,4)12(15)16-6-10(14)17-11-8-18-7-9(2)19-11/h9,11H,5-8H2,1-4H3.
What are the key properties of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate?
[2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate has a molecular weight of 306.45 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 59638006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).