About [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate
[2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 59638052) has the molecular formula C12H20O4S2
and a molecular weight of 292.42 g/mol. Its IUPAC name is [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate |
| PubChem CID | 59638052 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OC1CSCC(C)S1 |
| InChI | InChI=1S/C12H20O4S2/c1-4-8(2)12(14)15-5-10(13)16-11-7-17-6-9(3)18-11/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | WGSVMVIACVDBRY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate?
The IUPAC name of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate (CID 59638052) is [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate.
What is the SMILES notation for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate?
The canonical SMILES for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate is CCC(C)C(=O)OCC(=O)OC1CSCC(C)S1.
What is the InChIKey of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate?
The InChIKey is WGSVMVIACVDBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4S2/c1-4-8(2)12(14)15-5-10(13)16-11-7-17-6-9(3)18-11/h8-9,11H,4-7H2,1-3H3.
What are the key properties of [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate?
[2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate has a molecular weight of 292.42 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate is sourced from PubChem (CID 59638052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).