About (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate
(5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate (PubChem CID 59638144) has the molecular formula C8H13ClO3S
and a molecular weight of 224.71 g/mol. Its IUPAC name is (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate.
Molecular Properties
| Compound Name | (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate |
| PubChem CID | 59638144 |
| Molecular Formula | C8H13ClO3S |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate |
| SMILES | CC1OC(OC(=O)CCl)CSC1C |
| InChI | InChI=1S/C8H13ClO3S/c1-5-6(2)13-4-8(11-5)12-7(10)3-9/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | CVSFUEPPNSHVOP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate?
The IUPAC name of (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate (CID 59638144) is (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate.
What is the SMILES notation for (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate?
The canonical SMILES for (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate is CC1OC(OC(=O)CCl)CSC1C.
What is the InChIKey of (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate?
The InChIKey is CVSFUEPPNSHVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO3S/c1-5-6(2)13-4-8(11-5)12-7(10)3-9/h5-6,8H,3-4H2,1-2H3.
What are the key properties of (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate?
(5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate has a molecular weight of 224.71 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dimethyl-1,4-oxathian-2-yl) 2-chloroacetate is sourced from PubChem (CID 59638144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).