About 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one
3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 596384) has the molecular formula C20H22N2O4S
and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| PubChem CID | 596384 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\SCC(=O)N2CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-24-16-7-5-15(6-8-16)21-20-22(19(23)13-27-20)11-10-14-4-9-17(25-2)18(12-14)26-3/h4-9,12H,10-11,13H2,1-3H3/b21-20- |
| InChIKey | ONSBTJOSCNLELB-MRCUWXFGSA-N |
| XLogP | 3.52 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (CID 596384) is 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one is COc1ccc(/N=C2\SCC(=O)N2CCc2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one?
The InChIKey is ONSBTJOSCNLELB-MRCUWXFGSA-N. The full InChI is InChI=1S/C20H22N2O4S/c1-24-16-7-5-15(6-8-16)21-20-22(19(23)13-27-20)11-10-14-4-9-17(25-2)18(12-14)26-3/h4-9,12H,10-11,13H2,1-3H3/b21-20-.
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one?
3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one has a molecular weight of 386.47 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 596384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).