C14H22O6 — CID 59638507
ethyl 2-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-oxoacetate (PubChem CID 59638507) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is ethyl 2-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 59638507 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 2-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@]1(CC)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C14H22O6/c1-6-14(10(15)11(16)17-7-2)8(3)9-12(20-14)19-13(4,5)18-9/h8-9,12H,6-7H2,1-5H3/t8-,9-,12+,14+/m1/s1 |
| InChIKey | NSEUWHCMFUPHML-KZOHCQCBSA-N |
| XLogP | 1.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|