C9H14O2 — CID 59638538
(1R,3S,4S,7R)-1-ethyl-3-methyl-2-oxabicyclo[2.2.1]hept-5-en-7-ol (PubChem CID 59638538) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1R,3S,4S,7R)-1-ethyl-3-methyl-2-oxabicyclo[2.2.1]hept-5-en-7-ol.
| Compound Name | (1R,3S,4S,7R)-1-ethyl-3-methyl-2-oxabicyclo[2.2.1]hept-5-en-7-ol |
|---|---|
| PubChem CID | 59638538 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1R,3S,4S,7R)-1-ethyl-3-methyl-2-oxabicyclo[2.2.1]hept-5-en-7-ol |
| SMILES | CC[C@]12C=C[C@H]([C@H](C)O1)[C@H]2O |
| InChI | InChI=1S/C9H14O2/c1-3-9-5-4-7(8(9)10)6(2)11-9/h4-8,10H,3H2,1-2H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | OEOQKDVCUBXJPT-JQCXWYLXSA-N |
| XLogP | 1.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|