C28H27BN2O2 — CID 59638590
3-[3-pyridin-3-yl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine (PubChem CID 59638590) has the molecular formula C28H27BN2O2 and a molecular weight of 434.35 g/mol. Its IUPAC name is 3-[3-pyridin-3-yl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine.
| Compound Name | 3-[3-pyridin-3-yl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 59638590 |
| Molecular Formula | C28H27BN2O2 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 3-[3-pyridin-3-yl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
| SMILES | CC1(C)OB(c2cccc(-c3cc(-c4cccnc4)cc(-c4cccnc4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C28H27BN2O2/c1-27(2)28(3,4)33-29(32-27)26-11-5-8-20(17-26)23-14-24(21-9-6-12-30-18-21)16-25(15-23)22-10-7-13-31-19-22/h5-19H,1-4H3 |
| InChIKey | DFRIHRZRSCGPNO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|