About CID 59638689
CID 59638689 (PubChem CID 59638689) has the molecular formula C16H10
and a molecular weight of 202.26 g/mol.
Molecular Properties
| Compound Name | CID 59638689 |
| PubChem CID | 59638689 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | — |
| SMILES | [CH]c1c([CH])c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C16H10/c1-11-12(2)14-8-4-6-10-16(14)15-9-5-3-7-13(11)15/h1-10H |
| InChIKey | XBYSHHNQHRCGNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 59638689 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59638689?
The IUPAC name of CID 59638689 (CID 59638689) is not available.
What is the SMILES notation for CID 59638689?
The canonical SMILES for CID 59638689 is [CH]c1c([CH])c2ccccc2c2ccccc12.
What is the InChIKey of CID 59638689?
The InChIKey is XBYSHHNQHRCGNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10/c1-11-12(2)14-8-4-6-10-16(14)15-9-5-3-7-13(11)15/h1-10H.
What are the key properties of CID 59638689?
CID 59638689 has a molecular weight of 202.26 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59638689 is sourced from PubChem (CID 59638689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).