About 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol
2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol (PubChem CID 59638979) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol |
| PubChem CID | 59638979 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(CO)c(C)c1O |
| InChI | InChI=1S/C9H12O3/c1-5-3-8(11)7(4-10)6(2)9(5)12/h3,10-12H,4H2,1-2H3 |
| InChIKey | GJDIXKSMFHSPRO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol?
The IUPAC name of 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol (CID 59638979) is 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol.
What is the SMILES notation for 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol?
The canonical SMILES for 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol is Cc1cc(O)c(CO)c(C)c1O.
What is the InChIKey of 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol?
The InChIKey is GJDIXKSMFHSPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-5-3-8(11)7(4-10)6(2)9(5)12/h3,10-12H,4H2,1-2H3.
What are the key properties of 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol?
2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol has a molecular weight of 168.19 g/mol, XLogP of 1.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3,5-dimethylbenzene-1,4-diol is sourced from PubChem (CID 59638979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).