About 4,6-dimethyl-1,3-benzodioxol-5-ol
4,6-dimethyl-1,3-benzodioxol-5-ol (PubChem CID 59638998) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 4,6-dimethyl-1,3-benzodioxol-5-ol |
| PubChem CID | 59638998 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4,6-dimethyl-1,3-benzodioxol-5-ol |
| SMILES | Cc1cc2c(c(C)c1O)OCO2 |
| InChI | InChI=1S/C9H10O3/c1-5-3-7-9(12-4-11-7)6(2)8(5)10/h3,10H,4H2,1-2H3 |
| InChIKey | UIHXJYDYDIPKMG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethyl-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1,3-benzodioxol-5-ol?
The IUPAC name of 4,6-dimethyl-1,3-benzodioxol-5-ol (CID 59638998) is 4,6-dimethyl-1,3-benzodioxol-5-ol.
What is the SMILES notation for 4,6-dimethyl-1,3-benzodioxol-5-ol?
The canonical SMILES for 4,6-dimethyl-1,3-benzodioxol-5-ol is Cc1cc2c(c(C)c1O)OCO2.
What is the InChIKey of 4,6-dimethyl-1,3-benzodioxol-5-ol?
The InChIKey is UIHXJYDYDIPKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-5-3-7-9(12-4-11-7)6(2)8(5)10/h3,10H,4H2,1-2H3.
What are the key properties of 4,6-dimethyl-1,3-benzodioxol-5-ol?
4,6-dimethyl-1,3-benzodioxol-5-ol has a molecular weight of 166.18 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1,3-benzodioxol-5-ol is sourced from PubChem (CID 59638998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).