C40H53N3 — CID 59639061
4-[4-[4-[4-[4-(diethylamino)-2-ethylphenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]-1-N,1-N,3-N,3-N-tetraethylbenzene-1,3-diamine (PubChem CID 59639061) has the molecular formula C40H53N3 and a molecular weight of 575.89 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-(diethylamino)-2-ethylphenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]-1-N,1-N,3-N,3-N-tetraethylbenzene-1,3-diamine.
| Compound Name | 4-[4-[4-[4-[4-(diethylamino)-2-ethylphenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]-1-N,1-N,3-N,3-N-tetraethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 59639061 |
| Molecular Formula | C40H53N3 |
| Molecular Weight | 575.89 g/mol |
| Exact Mass | 575.42 |
| IUPAC Name | 4-[4-[4-[4-[4-(diethylamino)-2-ethylphenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]-1-N,1-N,3-N,3-N-tetraethylbenzene-1,3-diamine |
| SMILES | CCc1cc(N(CC)CC)ccc1C=CC=Cc1ccc(C=CC=Cc2ccc(N(CC)CC)cc2N(CC)CC)cc1 |
| InChI | InChI=1S/C40H53N3/c1-8-35-31-38(41(9-2)10-3)29-27-36(35)21-17-15-19-33-23-25-34(26-24-33)20-16-18-22-37-28-30-39(42(11-4)12-5)32-40(37)43(13-6)14-7/h15-32H,8-14H2,1-7H3 |
| InChIKey | WUJLRARRDILMOV-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.89 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|