C10H15N — CID 59639387
6-methyl-1,2,3,4,4a,8a-hexahydroquinoline (PubChem CID 59639387) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-methyl-1,2,3,4,4a,8a-hexahydroquinoline.
| Compound Name | 6-methyl-1,2,3,4,4a,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 59639387 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-methyl-1,2,3,4,4a,8a-hexahydroquinoline |
| SMILES | CC1=CC2CCCNC2C=C1 |
| InChI | InChI=1S/C10H15N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,9-11H,2-3,6H2,1H3 |
| InChIKey | MUBFBABIQOBPKN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |