C29H23F3N6O2 — CID 59639557
1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-phenylurea (PubChem CID 59639557) has the molecular formula C29H23F3N6O2 and a molecular weight of 544.54 g/mol. Its IUPAC name is 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 59639557 |
| Molecular Formula | C29H23F3N6O2 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-phenylurea |
| SMILES | Cc1cc(F)ccc1-c1nc(NCCNC(=O)Nc2ccccc2)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C29H23F3N6O2/c1-17-16-18(30)10-11-20(17)25-21-12-13-24(39)38(26-22(31)8-5-9-23(26)32)27(21)37-28(36-25)33-14-15-34-29(40)35-19-6-3-2-4-7-19/h2-13,16H,14-15H2,1H3,(H,33,36,37)(H2,34,35,40) |
| InChIKey | IXIXLADQBKUHRP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|