About 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol
3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 596401) has the molecular formula C17H18O4
and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| PubChem CID | 596401 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | COc1ccc(C2COc3cc(O)ccc3C2)c(OC)c1 |
| InChI | InChI=1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3 |
| InChIKey | TUXCLJQCYVCGDW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol (CID 596401) is 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol is COc1ccc(C2COc3cc(O)ccc3C2)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol?
The InChIKey is TUXCLJQCYVCGDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3.
What are the key properties of 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol?
3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol has a molecular weight of 286.33 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol is sourced from PubChem (CID 596401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).