About (2R)-1-methoxy-N,4-dimethylpentan-2-amine
(2R)-1-methoxy-N,4-dimethylpentan-2-amine (PubChem CID 59640405) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is (2R)-1-methoxy-N,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-methoxy-N,4-dimethylpentan-2-amine |
| PubChem CID | 59640405 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (2R)-1-methoxy-N,4-dimethylpentan-2-amine |
| SMILES | CN[C@@H](COC)CC(C)C |
| InChI | InChI=1S/C8H19NO/c1-7(2)5-8(9-3)6-10-4/h7-9H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | WUGUUPDSMYJEAA-MRVPVSSYSA-N |
| XLogP | 1.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-methoxy-N,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-methoxy-N,4-dimethylpentan-2-amine?
The IUPAC name of (2R)-1-methoxy-N,4-dimethylpentan-2-amine (CID 59640405) is (2R)-1-methoxy-N,4-dimethylpentan-2-amine.
What is the SMILES notation for (2R)-1-methoxy-N,4-dimethylpentan-2-amine?
The canonical SMILES for (2R)-1-methoxy-N,4-dimethylpentan-2-amine is CN[C@@H](COC)CC(C)C.
What is the InChIKey of (2R)-1-methoxy-N,4-dimethylpentan-2-amine?
The InChIKey is WUGUUPDSMYJEAA-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H19NO/c1-7(2)5-8(9-3)6-10-4/h7-9H,5-6H2,1-4H3/t8-/m1/s1.
What are the key properties of (2R)-1-methoxy-N,4-dimethylpentan-2-amine?
(2R)-1-methoxy-N,4-dimethylpentan-2-amine has a molecular weight of 145.25 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-methoxy-N,4-dimethylpentan-2-amine is sourced from PubChem (CID 59640405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).