About 2-tert-butyl-1-methyl-3,8a-dihydroindolizine
2-tert-butyl-1-methyl-3,8a-dihydroindolizine (PubChem CID 59640670) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-3,8a-dihydroindolizine.
Molecular Properties
| Compound Name | 2-tert-butyl-1-methyl-3,8a-dihydroindolizine |
| PubChem CID | 59640670 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-tert-butyl-1-methyl-3,8a-dihydroindolizine |
| SMILES | CC1=C(C(C)(C)C)CN2C=CC=CC12 |
| InChI | InChI=1S/C13H19N/c1-10-11(13(2,3)4)9-14-8-6-5-7-12(10)14/h5-8,12H,9H2,1-4H3 |
| InChIKey | CLTVSIVWTCQJCY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-methyl-3,8a-dihydroindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-methyl-3,8a-dihydroindolizine?
The IUPAC name of 2-tert-butyl-1-methyl-3,8a-dihydroindolizine (CID 59640670) is 2-tert-butyl-1-methyl-3,8a-dihydroindolizine.
What is the SMILES notation for 2-tert-butyl-1-methyl-3,8a-dihydroindolizine?
The canonical SMILES for 2-tert-butyl-1-methyl-3,8a-dihydroindolizine is CC1=C(C(C)(C)C)CN2C=CC=CC12.
What is the InChIKey of 2-tert-butyl-1-methyl-3,8a-dihydroindolizine?
The InChIKey is CLTVSIVWTCQJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-10-11(13(2,3)4)9-14-8-6-5-7-12(10)14/h5-8,12H,9H2,1-4H3.
What are the key properties of 2-tert-butyl-1-methyl-3,8a-dihydroindolizine?
2-tert-butyl-1-methyl-3,8a-dihydroindolizine has a molecular weight of 189.30 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-methyl-3,8a-dihydroindolizine is sourced from PubChem (CID 59640670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).