methyl 4-amino-5-methylthiophene-2-carboxylate

C7H9NO2S — CID 59640747

IUPACmethyl 4-amino-5-methylthiophene-2-carboxylate
SMILESCOC(=O)c1cc(N)c(C)s1
InChIInChI=1S/C7H9NO2S/c1-4-5(8)3-6(11-4)7(9)10-2/h3H,8H2,1-2H3
InChIKeyZTTXAKCLKGBDIR-UHFFFAOYSA-N
MW171.22 g/mol
LogP1.43
Rot. Bonds1

About methyl 4-amino-5-methylthiophene-2-carboxylate

methyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 59640747) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is methyl 4-amino-5-methylthiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-amino-5-methylthiophene-2-carboxylate
PubChem CID59640747
Molecular FormulaC7H9NO2S
Molecular Weight171.22 g/mol
Exact Mass171.04
IUPAC Namemethyl 4-amino-5-methylthiophene-2-carboxylate
SMILESCOC(=O)c1cc(N)c(C)s1
InChIInChI=1S/C7H9NO2S/c1-4-5(8)3-6(11-4)7(9)10-2/h3H,8H2,1-2H3
InChIKeyZTTXAKCLKGBDIR-UHFFFAOYSA-N
XLogP1.43
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.22
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-amino-5-methylthiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of methyl 4-amino-5-methylthiophene-2-carboxylate (CID 59640747) is methyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for methyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for methyl 4-amino-5-methylthiophene-2-carboxylate is COC(=O)c1cc(N)c(C)s1.
What is the InChIKey of methyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is ZTTXAKCLKGBDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-4-5(8)3-6(11-4)7(9)10-2/h3H,8H2,1-2H3.
What are the key properties of methyl 4-amino-5-methylthiophene-2-carboxylate?
methyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 171.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 59640747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).