About 6-methyl-7,8-dihydro-1H-pteridin-2-one
6-methyl-7,8-dihydro-1H-pteridin-2-one (PubChem CID 596409) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 6-methyl-7,8-dihydro-1H-pteridin-2-one.
Molecular Properties
| Compound Name | 6-methyl-7,8-dihydro-1H-pteridin-2-one |
| PubChem CID | 596409 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-methyl-7,8-dihydro-1H-pteridin-2-one |
| SMILES | CC1=Nc2cnc(=O)[nH]c2NC1 |
| InChI | InChI=1S/C7H8N4O/c1-4-2-8-6-5(10-4)3-9-7(12)11-6/h3H,2H2,1H3,(H2,8,9,11,12) |
| InChIKey | VSTHSUFIPXGKSB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-7,8-dihydro-1H-pteridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7,8-dihydro-1H-pteridin-2-one?
The IUPAC name of 6-methyl-7,8-dihydro-1H-pteridin-2-one (CID 596409) is 6-methyl-7,8-dihydro-1H-pteridin-2-one.
What is the SMILES notation for 6-methyl-7,8-dihydro-1H-pteridin-2-one?
The canonical SMILES for 6-methyl-7,8-dihydro-1H-pteridin-2-one is CC1=Nc2cnc(=O)[nH]c2NC1.
What is the InChIKey of 6-methyl-7,8-dihydro-1H-pteridin-2-one?
The InChIKey is VSTHSUFIPXGKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-4-2-8-6-5(10-4)3-9-7(12)11-6/h3H,2H2,1H3,(H2,8,9,11,12).
What are the key properties of 6-methyl-7,8-dihydro-1H-pteridin-2-one?
6-methyl-7,8-dihydro-1H-pteridin-2-one has a molecular weight of 164.17 g/mol, XLogP of 0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7,8-dihydro-1H-pteridin-2-one is sourced from PubChem (CID 596409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).