C17H10F16O — CID 59641467
1-ethenyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)benzene (PubChem CID 59641467) has the molecular formula C17H10F16O and a molecular weight of 534.23 g/mol. Its IUPAC name is 1-ethenyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)benzene.
| Compound Name | 1-ethenyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)benzene |
|---|---|
| PubChem CID | 59641467 |
| Molecular Formula | C17H10F16O |
| Molecular Weight | 534.23 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 1-ethenyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)benzene |
| SMILES | C=Cc1cccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C17H10F16O/c1-2-8-4-3-5-9(6-8)34-7-11(20,21)13(24,25)15(28,29)17(32,33)16(30,31)14(26,27)12(22,23)10(18)19/h2-6,10H,1,7H2 |
| InChIKey | NJOHBVYCODUGGK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.23 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|