C20H28O4 — CID 59641665
[3,5,5-trimethyl-4-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate (PubChem CID 59641665) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [3,5,5-trimethyl-4-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate.
| Compound Name | [3,5,5-trimethyl-4-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 59641665 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [3,5,5-trimethyl-4-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
| SMILES | C/C=C(C)/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C |
| InChI | InChI=1S/C20H28O4/c1-7-13(2)8-10-16-15(4)19(23)17(12-20(16,5)6)24-18(22)11-9-14(3)21/h7-8,10,17H,9,11-12H2,1-6H3/b10-8+,13-7+ |
| InChIKey | MODGYVUHZLXWSI-YJDDGFGUSA-N |
| XLogP | 4.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|